C13H8F6O3 — CID 137483304
5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-2-benzofuran-1,3-dione (PubChem CID 137483304) has the molecular formula C13H8F6O3 and a molecular weight of 326.19 g/mol. Its IUPAC name is 5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 137483304 |
| Molecular Formula | C13H8F6O3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 5-[3,3,3-trifluoro-2-methyl-2-(trifluoromethyl)propyl]-2-benzofuran-1,3-dione |
| SMILES | CC(Cc1ccc2c(c1)C(=O)OC2=O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H8F6O3/c1-11(12(14,15)16,13(17,18)19)5-6-2-3-7-8(4-6)10(21)22-9(7)20/h2-4H,5H2,1H3 |
| InChIKey | MPRLKJAGDJFTSW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|