About 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine
6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine (PubChem CID 137483332) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine |
| PubChem CID | 137483332 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine |
| SMILES | COC1=CC(C2CCNCC2)CC=C1N |
| InChI | InChI=1S/C12H20N2O/c1-15-12-8-10(2-3-11(12)13)9-4-6-14-7-5-9/h3,8-10,14H,2,4-7,13H2,1H3 |
| InChIKey | ISEZEXMTWQVOHV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine?
The IUPAC name of 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine (CID 137483332) is 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine is COC1=CC(C2CCNCC2)CC=C1N.
What is the InChIKey of 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine?
The InChIKey is ISEZEXMTWQVOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-15-12-8-10(2-3-11(12)13)9-4-6-14-7-5-9/h3,8-10,14H,2,4-7,13H2,1H3.
What are the key properties of 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine?
6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine has a molecular weight of 208.30 g/mol, XLogP of 1.38, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-4-piperidin-4-ylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 137483332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).