C26H39N3 — CID 137483431
(E)-[(2Z)-4-(2,3-dimethylcyclohexa-1,5-dien-1-yl)-3-ethyl-2,8,8-trimethyl-6-methylimino-4,7,9,10-tetrahydro-1H-1-benzazocin-5-ylidene]methanamine (PubChem CID 137483431) has the molecular formula C26H39N3 and a molecular weight of 393.62 g/mol. Its IUPAC name is (E)-[(2Z)-4-(2,3-dimethylcyclohexa-1,5-dien-1-yl)-3-ethyl-2,8,8-trimethyl-6-methylimino-4,7,9,10-tetrahydro-1H-1-benzazocin-5-ylidene]methanamine.
| Compound Name | (E)-[(2Z)-4-(2,3-dimethylcyclohexa-1,5-dien-1-yl)-3-ethyl-2,8,8-trimethyl-6-methylimino-4,7,9,10-tetrahydro-1H-1-benzazocin-5-ylidene]methanamine |
|---|---|
| PubChem CID | 137483431 |
| Molecular Formula | C26H39N3 |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.31 |
| IUPAC Name | (E)-[(2Z)-4-(2,3-dimethylcyclohexa-1,5-dien-1-yl)-3-ethyl-2,8,8-trimethyl-6-methylimino-4,7,9,10-tetrahydro-1H-1-benzazocin-5-ylidene]methanamine |
| SMILES | CC/C1=C(\C)NC2=C(CC(C)(C)CC2)C(=N\C)/C(=C/N)C1C1=C(C)C(C)CC=C1 |
| InChI | InChI=1S/C26H39N3/c1-8-19-18(4)29-23-12-13-26(5,6)14-21(23)25(28-7)22(15-27)24(19)20-11-9-10-16(2)17(20)3/h9,11,15-16,24,29H,8,10,12-14,27H2,1-7H3/b19-18-,22-15+,28-25+ |
| InChIKey | VQNNQFBNKIGJTO-BIGLXJLTSA-N |
| XLogP | 6.18 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|