C23H32FN3 — CID 137483452
(5Z)-6-N-[(4,4-dimethylcyclohexylidene)amino]-4-(3-fluorophenyl)-2-N-methyl-3-methylidenehepta-1,5-diene-2,6-diamine (PubChem CID 137483452) has the molecular formula C23H32FN3 and a molecular weight of 369.53 g/mol. Its IUPAC name is (5Z)-6-N-[(4,4-dimethylcyclohexylidene)amino]-4-(3-fluorophenyl)-2-N-methyl-3-methylidenehepta-1,5-diene-2,6-diamine.
| Compound Name | (5Z)-6-N-[(4,4-dimethylcyclohexylidene)amino]-4-(3-fluorophenyl)-2-N-methyl-3-methylidenehepta-1,5-diene-2,6-diamine |
|---|---|
| PubChem CID | 137483452 |
| Molecular Formula | C23H32FN3 |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | (5Z)-6-N-[(4,4-dimethylcyclohexylidene)amino]-4-(3-fluorophenyl)-2-N-methyl-3-methylidenehepta-1,5-diene-2,6-diamine |
| SMILES | C=C(NC)C(=C)C(/C=C(/C)NN=C1CCC(C)(C)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C23H32FN3/c1-16(26-27-21-10-12-23(4,5)13-11-21)14-22(17(2)18(3)25-6)19-8-7-9-20(24)15-19/h7-9,14-15,22,25-26H,2-3,10-13H2,1,4-6H3/b16-14- |
| InChIKey | UKAMUIPEHXBKPJ-PEZBUJJGSA-N |
| XLogP | 5.65 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|