C27H42N2 — CID 137483466
(1E,5Z,7Z)-1-(5,5-dimethyl-2-methyliminocyclohexylidene)-3-(2,4-dimethylpent-2-en-3-yl)-2,4-dimethylidenenona-5,7-dien-1-amine (PubChem CID 137483466) has the molecular formula C27H42N2 and a molecular weight of 394.65 g/mol. Its IUPAC name is (1E,5Z,7Z)-1-(5,5-dimethyl-2-methyliminocyclohexylidene)-3-(2,4-dimethylpent-2-en-3-yl)-2,4-dimethylidenenona-5,7-dien-1-amine.
| Compound Name | (1E,5Z,7Z)-1-(5,5-dimethyl-2-methyliminocyclohexylidene)-3-(2,4-dimethylpent-2-en-3-yl)-2,4-dimethylidenenona-5,7-dien-1-amine |
|---|---|
| PubChem CID | 137483466 |
| Molecular Formula | C27H42N2 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | (1E,5Z,7Z)-1-(5,5-dimethyl-2-methyliminocyclohexylidene)-3-(2,4-dimethylpent-2-en-3-yl)-2,4-dimethylidenenona-5,7-dien-1-amine |
| SMILES | C=C(/C=C\C=C/C)C(C(=C)/C(N)=C1/CC(C)(C)CC/C1=N\C)C(=C(C)C)C(C)C |
| InChI | InChI=1S/C27H42N2/c1-11-12-13-14-20(6)25(24(18(2)3)19(4)5)21(7)26(28)22-17-27(8,9)16-15-23(22)29-10/h11-14,18,25H,6-7,15-17,28H2,1-5,8-10H3/b12-11-,14-13-,26-22+,29-23+ |
| InChIKey | WNPJHSMANJEITB-DBARHIOZSA-N |
| XLogP | 7.33 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|