C9H16F3IN4 — CID 137483603
2-methyl-1-[(E)-3,3,3-trifluoro-2-[(1-iodopropylamino)methyl]prop-1-enyl]guanidine (PubChem CID 137483603) has the molecular formula C9H16F3IN4 and a molecular weight of 364.15 g/mol. Its IUPAC name is 2-methyl-1-[(E)-3,3,3-trifluoro-2-[(1-iodopropylamino)methyl]prop-1-enyl]guanidine.
| Compound Name | 2-methyl-1-[(E)-3,3,3-trifluoro-2-[(1-iodopropylamino)methyl]prop-1-enyl]guanidine |
|---|---|
| PubChem CID | 137483603 |
| Molecular Formula | C9H16F3IN4 |
| Molecular Weight | 364.15 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 2-methyl-1-[(E)-3,3,3-trifluoro-2-[(1-iodopropylamino)methyl]prop-1-enyl]guanidine |
| SMILES | CCC(I)NC/C(=C\N/C(N)=N/C)C(F)(F)F |
| InChI | InChI=1S/C9H16F3IN4/c1-3-7(13)16-4-6(9(10,11)12)5-17-8(14)15-2/h5,7,16H,3-4H2,1-2H3,(H3,14,15,17)/b6-5+ |
| InChIKey | BXLHDWSFTKITQG-AATRIKPKSA-N |
| XLogP | 1.73 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.15 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|