C18H31NO5 — CID 137483998
(2R,3R,4R,5S)-1-[(4-butoxy-3-methylcyclohexa-1,5-dien-1-yl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 137483998) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[(4-butoxy-3-methylcyclohexa-1,5-dien-1-yl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[(4-butoxy-3-methylcyclohexa-1,5-dien-1-yl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 137483998 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (2R,3R,4R,5S)-1-[(4-butoxy-3-methylcyclohexa-1,5-dien-1-yl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | CCCCOC1C=CC(CN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)=CC1C |
| InChI | InChI=1S/C18H31NO5/c1-3-4-7-24-16-6-5-13(8-12(16)2)9-19-10-15(21)18(23)17(22)14(19)11-20/h5-6,8,12,14-18,20-23H,3-4,7,9-11H2,1-2H3/t12?,14-,15+,16?,17-,18-/m1/s1 |
| InChIKey | OKAJYVONKRUVMO-KEOHJIHASA-N |
| XLogP | 0.06 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|