C14H24S — CID 137484274
6-ethylsulfanyl-2,4,5-trimethyl-3-prop-1-en-2-ylhexa-1,3-diene (PubChem CID 137484274) has the molecular formula C14H24S and a molecular weight of 224.41 g/mol. Its IUPAC name is 6-ethylsulfanyl-2,4,5-trimethyl-3-prop-1-en-2-ylhexa-1,3-diene.
| Compound Name | 6-ethylsulfanyl-2,4,5-trimethyl-3-prop-1-en-2-ylhexa-1,3-diene |
|---|---|
| PubChem CID | 137484274 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 6-ethylsulfanyl-2,4,5-trimethyl-3-prop-1-en-2-ylhexa-1,3-diene |
| SMILES | C=C(C)C(C(=C)C)=C(C)C(C)CSCC |
| InChI | InChI=1S/C14H24S/c1-8-15-9-12(6)13(7)14(10(2)3)11(4)5/h12H,2,4,8-9H2,1,3,5-7H3 |
| InChIKey | UCWUWLSIZZMUSE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|