C49H25F4N7 — CID 137484387
3-[4-[4-[3,5-difluoro-4-(1,10-phenanthrolin-3-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-2,6-difluorophenyl]-1,10-phenanthroline (PubChem CID 137484387) has the molecular formula C49H25F4N7 and a molecular weight of 787.78 g/mol. Its IUPAC name is 3-[4-[4-[3,5-difluoro-4-(1,10-phenanthrolin-3-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-2,6-difluorophenyl]-1,10-phenanthroline.
| Compound Name | 3-[4-[4-[3,5-difluoro-4-(1,10-phenanthrolin-3-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-2,6-difluorophenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 137484387 |
| Molecular Formula | C49H25F4N7 |
| Molecular Weight | 787.78 g/mol |
| Exact Mass | 787.21 |
| IUPAC Name | 3-[4-[4-[3,5-difluoro-4-(1,10-phenanthrolin-3-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-2,6-difluorophenyl]-1,10-phenanthroline |
| SMILES | Fc1cc(-c2nc(-c3cc(F)c(-c4cnc5c(ccc6cccnc65)c4)c(F)c3)nc(-c3ccc4ccccc4c3)n2)cc(F)c1-c1cnc2c(ccc3cccnc32)c1 |
| InChI | InChI=1S/C49H25F4N7/c50-37-20-33(21-38(51)41(37)35-18-30-12-10-27-7-3-15-54-43(27)45(30)56-24-35)48-58-47(32-14-9-26-5-1-2-6-29(26)17-32)59-49(60-48)34-22-39(52)42(40(53)23-34)36-19-31-13-11-28-8-4-16-55-44(28)46(31)57-25-36/h1-25H |
| InChIKey | JXRBVJBPHAIGFS-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.78 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|