C45H25F2N7 — CID 137484459
3-[3-fluoro-5-[4-[3-fluoro-5-(1,10-phenanthrolin-3-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline (PubChem CID 137484459) has the molecular formula C45H25F2N7 and a molecular weight of 701.74 g/mol. Its IUPAC name is 3-[3-fluoro-5-[4-[3-fluoro-5-(1,10-phenanthrolin-3-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 3-[3-fluoro-5-[4-[3-fluoro-5-(1,10-phenanthrolin-3-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 137484459 |
| Molecular Formula | C45H25F2N7 |
| Molecular Weight | 701.74 g/mol |
| Exact Mass | 701.21 |
| IUPAC Name | 3-[3-fluoro-5-[4-[3-fluoro-5-(1,10-phenanthrolin-3-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline |
| SMILES | Fc1cc(-c2cnc3c(ccc4cccnc43)c2)cc(-c2nc(-c3ccccc3)nc(-c3cc(F)cc(-c4cnc5c(ccc6cccnc65)c4)c3)n2)c1 |
| InChI | InChI=1S/C45H25F2N7/c46-37-20-31(35-16-29-12-10-26-8-4-14-48-39(26)41(29)50-24-35)18-33(22-37)44-52-43(28-6-2-1-3-7-28)53-45(54-44)34-19-32(21-38(47)23-34)36-17-30-13-11-27-9-5-15-49-40(27)42(30)51-25-36/h1-25H |
| InChIKey | VFYLPGPTZFXRRR-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.74 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|