C47H28F2N6 — CID 137484539
3-[3-fluoro-4-[2-[2-fluoro-4-(1,10-phenanthrolin-3-yl)phenyl]-5-methyl-6-phenylpyrimidin-4-yl]phenyl]-1,10-phenanthroline (PubChem CID 137484539) has the molecular formula C47H28F2N6 and a molecular weight of 714.78 g/mol. Its IUPAC name is 3-[3-fluoro-4-[2-[2-fluoro-4-(1,10-phenanthrolin-3-yl)phenyl]-5-methyl-6-phenylpyrimidin-4-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 3-[3-fluoro-4-[2-[2-fluoro-4-(1,10-phenanthrolin-3-yl)phenyl]-5-methyl-6-phenylpyrimidin-4-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 137484539 |
| Molecular Formula | C47H28F2N6 |
| Molecular Weight | 714.78 g/mol |
| Exact Mass | 714.23 |
| IUPAC Name | 3-[3-fluoro-4-[2-[2-fluoro-4-(1,10-phenanthrolin-3-yl)phenyl]-5-methyl-6-phenylpyrimidin-4-yl]phenyl]-1,10-phenanthroline |
| SMILES | Cc1c(-c2ccccc2)nc(-c2ccc(-c3cnc4c(ccc5cccnc54)c3)cc2F)nc1-c1ccc(-c2cnc3c(ccc4cccnc43)c2)cc1F |
| InChI | InChI=1S/C47H28F2N6/c1-27-41(28-7-3-2-4-8-28)54-47(38-18-16-32(24-40(38)49)36-22-34-14-12-30-10-6-20-51-44(30)46(34)53-26-36)55-42(27)37-17-15-31(23-39(37)48)35-21-33-13-11-29-9-5-19-50-43(29)45(33)52-25-35/h2-26H,1H3 |
| InChIKey | HYYMCURCLFTMKH-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.78 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|