C48H25F4N7 — CID 137484614
5-[4-[4-[3,5-difluoro-4-(1H-pyrrolo[3,2-h]quinolin-4-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-2,6-difluorophenyl]-1,10-phenanthroline (PubChem CID 137484614) has the molecular formula C48H25F4N7 and a molecular weight of 775.77 g/mol. Its IUPAC name is 5-[4-[4-[3,5-difluoro-4-(1H-pyrrolo[3,2-h]quinolin-4-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-2,6-difluorophenyl]-1,10-phenanthroline.
| Compound Name | 5-[4-[4-[3,5-difluoro-4-(1H-pyrrolo[3,2-h]quinolin-4-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-2,6-difluorophenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 137484614 |
| Molecular Formula | C48H25F4N7 |
| Molecular Weight | 775.77 g/mol |
| Exact Mass | 775.21 |
| IUPAC Name | 5-[4-[4-[3,5-difluoro-4-(1H-pyrrolo[3,2-h]quinolin-4-yl)phenyl]-6-naphthalen-2-yl-1,3,5-triazin-2-yl]-2,6-difluorophenyl]-1,10-phenanthroline |
| SMILES | Fc1cc(-c2nc(-c3cc(F)c(-c4cc5cccnc5c5[nH]ccc45)c(F)c3)nc(-c3ccc4ccccc4c3)n2)cc(F)c1-c1cc2cccnc2c2ncccc12 |
| InChI | InChI=1S/C48H25F4N7/c49-36-21-30(22-37(50)40(36)34-19-27-8-3-14-53-42(27)44-32(34)10-5-16-55-44)47-57-46(29-12-11-25-6-1-2-7-26(25)18-29)58-48(59-47)31-23-38(51)41(39(52)24-31)35-20-28-9-4-15-54-43(28)45-33(35)13-17-56-45/h1-24,56H |
| InChIKey | PAKVWCPZXKYBKQ-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.77 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|