About 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine
4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine (PubChem CID 137484741) has the molecular formula C12H16N2S
and a molecular weight of 220.34 g/mol. Its IUPAC name is 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine |
| PubChem CID | 137484741 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine |
| SMILES | NC1=CCC(SC2=CCC(N)C=C2)C=C1 |
| InChI | InChI=1S/C12H16N2S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-3,5,7-8,10-11H,4,6,13-14H2 |
| InChIKey | KVSUTADWRJLSRX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine?
The IUPAC name of 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine (CID 137484741) is 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine?
The canonical SMILES for 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine is NC1=CCC(SC2=CCC(N)C=C2)C=C1.
What is the InChIKey of 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine?
The InChIKey is KVSUTADWRJLSRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2S/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-3,5,7-8,10-11H,4,6,13-14H2.
What are the key properties of 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine?
4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine has a molecular weight of 220.34 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminocyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 137484741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).