About 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine
1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine (PubChem CID 137484831) has the molecular formula C11H17F2NO2
and a molecular weight of 233.26 g/mol. Its IUPAC name is 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine.
Molecular Properties
| Compound Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine |
| PubChem CID | 137484831 |
| Molecular Formula | C11H17F2NO2 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine |
| SMILES | FC1(F)CN(C2CCC3(CC2)OCCO3)C1 |
| InChI | InChI=1S/C11H17F2NO2/c12-10(13)7-14(8-10)9-1-3-11(4-2-9)15-5-6-16-11/h9H,1-8H2 |
| InChIKey | LNZROASBUHGSAG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine?
The IUPAC name of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine (CID 137484831) is 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine.
What is the SMILES notation for 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine?
The canonical SMILES for 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine is FC1(F)CN(C2CCC3(CC2)OCCO3)C1.
What is the InChIKey of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine?
The InChIKey is LNZROASBUHGSAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2NO2/c12-10(13)7-14(8-10)9-1-3-11(4-2-9)15-5-6-16-11/h9H,1-8H2.
What are the key properties of 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine?
1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine has a molecular weight of 233.26 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-dioxaspiro[4.5]decan-8-yl)-3,3-difluoroazetidine is sourced from PubChem (CID 137484831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).