C24H26ClFN6O — CID 137484935
8-chloro-1-[2-(5-fluoro-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-5-(2-methoxyethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 137484935) has the molecular formula C24H26ClFN6O and a molecular weight of 468.96 g/mol. Its IUPAC name is 8-chloro-1-[2-(5-fluoro-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-5-(2-methoxyethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-1-[2-(5-fluoro-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-5-(2-methoxyethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 137484935 |
| Molecular Formula | C24H26ClFN6O |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 8-chloro-1-[2-(5-fluoro-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-5-(2-methoxyethyl)-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | COCCN1Cc2cc(Cl)ccc2-n2c(nnc2C2CC3(C2)CN(c2ccc(F)cn2)C3)C1 |
| InChI | InChI=1S/C24H26ClFN6O/c1-33-7-6-30-12-16-8-18(25)2-4-20(16)32-22(13-30)28-29-23(32)17-9-24(10-17)14-31(15-24)21-5-3-19(26)11-27-21/h2-5,8,11,17H,6-7,9-10,12-15H2,1H3 |
| InChIKey | ZQNMUPHKKBPFDF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |