C24H24ClF3N6O — CID 137485135
8-chloro-5-cyclopropyl-1-[1-[3-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 137485135) has the molecular formula C24H24ClF3N6O and a molecular weight of 504.94 g/mol. Its IUPAC name is 8-chloro-5-cyclopropyl-1-[1-[3-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-5-cyclopropyl-1-[1-[3-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 137485135 |
| Molecular Formula | C24H24ClF3N6O |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 8-chloro-5-cyclopropyl-1-[1-[3-(trifluoromethoxy)-2-pyridinyl]piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | FC(F)(F)Oc1cccnc1N1CCC(c2nnc3n2-c2ccc(Cl)cc2CN(C2CC2)C3)CC1 |
| InChI | InChI=1S/C24H24ClF3N6O/c25-17-3-6-19-16(12-17)13-33(18-4-5-18)14-21-30-31-22(34(19)21)15-7-10-32(11-8-15)23-20(2-1-9-29-23)35-24(26,27)28/h1-3,6,9,12,15,18H,4-5,7-8,10-11,13-14H2 |
| InChIKey | GCBCAZBJEMWQJJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |