C22H19ClF3N5O2 — CID 137485139
1-[8-chloro-1-(1-pyrazin-2-ylpiperidin-4-yl)-4,6-dihydro-[1,2]oxazolo[5,4-d][2]benzazepin-5-yl]-2,2,2-trifluoroethanone (PubChem CID 137485139) has the molecular formula C22H19ClF3N5O2 and a molecular weight of 477.87 g/mol. Its IUPAC name is 1-[8-chloro-1-(1-pyrazin-2-ylpiperidin-4-yl)-4,6-dihydro-[1,2]oxazolo[5,4-d][2]benzazepin-5-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[8-chloro-1-(1-pyrazin-2-ylpiperidin-4-yl)-4,6-dihydro-[1,2]oxazolo[5,4-d][2]benzazepin-5-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 137485139 |
| Molecular Formula | C22H19ClF3N5O2 |
| Molecular Weight | 477.87 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 1-[8-chloro-1-(1-pyrazin-2-ylpiperidin-4-yl)-4,6-dihydro-[1,2]oxazolo[5,4-d][2]benzazepin-5-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1Cc2cc(Cl)ccc2-c2c(C3CCN(c4cnccn4)CC3)noc2C1)C(F)(F)F |
| InChI | InChI=1S/C22H19ClF3N5O2/c23-15-1-2-16-14(9-15)11-31(21(32)22(24,25)26)12-17-19(16)20(29-33-17)13-3-7-30(8-4-13)18-10-27-5-6-28-18/h1-2,5-6,9-10,13H,3-4,7-8,11-12H2 |
| InChIKey | PGUCFDAQAAZKFD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 75.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.87 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |