C23H25ClN8 — CID 137485248
8-chloro-5-methyl-1-[1-(1-methylpyrazolo[5,4-b]pyridin-3-yl)piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 137485248) has the molecular formula C23H25ClN8 and a molecular weight of 448.96 g/mol. Its IUPAC name is 8-chloro-5-methyl-1-[1-(1-methylpyrazolo[5,4-b]pyridin-3-yl)piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-5-methyl-1-[1-(1-methylpyrazolo[5,4-b]pyridin-3-yl)piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 137485248 |
| Molecular Formula | C23H25ClN8 |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 8-chloro-5-methyl-1-[1-(1-methylpyrazolo[5,4-b]pyridin-3-yl)piperidin-4-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | CN1Cc2cc(Cl)ccc2-n2c(nnc2C2CCN(c3nn(C)c4ncccc34)CC2)C1 |
| InChI | InChI=1S/C23H25ClN8/c1-29-13-16-12-17(24)5-6-19(16)32-20(14-29)26-27-21(32)15-7-10-31(11-8-15)23-18-4-3-9-25-22(18)30(2)28-23/h3-6,9,12,15H,7-8,10-11,13-14H2,1-2H3 |
| InChIKey | SEHVFUFEZCRBIT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |