C25H26ClFN6O — CID 137485418
8-chloro-5-cyclopropyl-1-[2-(5-fluoro-4-methoxy-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (PubChem CID 137485418) has the molecular formula C25H26ClFN6O and a molecular weight of 480.98 g/mol. Its IUPAC name is 8-chloro-5-cyclopropyl-1-[2-(5-fluoro-4-methoxy-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine.
| Compound Name | 8-chloro-5-cyclopropyl-1-[2-(5-fluoro-4-methoxy-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
|---|---|
| PubChem CID | 137485418 |
| Molecular Formula | C25H26ClFN6O |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 8-chloro-5-cyclopropyl-1-[2-(5-fluoro-4-methoxy-2-pyridinyl)-2-azaspiro[3.3]heptan-6-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| SMILES | COc1cc(N2CC3(CC(c4nnc5n4-c4ccc(Cl)cc4CN(C4CC4)C5)C3)C2)ncc1F |
| InChI | InChI=1S/C25H26ClFN6O/c1-34-21-7-22(28-10-19(21)27)32-13-25(14-32)8-16(9-25)24-30-29-23-12-31(18-3-4-18)11-15-6-17(26)2-5-20(15)33(23)24/h2,5-7,10,16,18H,3-4,8-9,11-14H2,1H3 |
| InChIKey | WTDOABSHMWPUKH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |