C20H35ClN4O7S — CID 137487075
(5aR,8S,8aR)-8-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-N-ethyl-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine-4,8-dicarboxamide (PubChem CID 137487075) has the molecular formula C20H35ClN4O7S and a molecular weight of 511.04 g/mol. Its IUPAC name is (5aR,8S,8aR)-8-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-N-ethyl-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine-4,8-dicarboxamide.
| Compound Name | (5aR,8S,8aR)-8-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-N-ethyl-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine-4,8-dicarboxamide |
|---|---|
| PubChem CID | 137487075 |
| Molecular Formula | C20H35ClN4O7S |
| Molecular Weight | 511.04 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | (5aR,8S,8aR)-8-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-N-ethyl-2,3,5,5a,6,7,8,8a-octahydropyrrolo[3,4-f][1,4]oxazepine-4,8-dicarboxamide |
| SMILES | CCNC(=O)N1CCO[C@@H]2[C@H](CN[C@@H]2C(=O)N[C@@H](C2OC(SC)C(O)C(O)C2O)[C@H](C)Cl)C1 |
| InChI | InChI=1S/C20H35ClN4O7S/c1-4-22-20(30)25-5-6-31-16-10(8-25)7-23-12(16)18(29)24-11(9(2)21)17-14(27)13(26)15(28)19(32-17)33-3/h9-17,19,23,26-28H,4-8H2,1-3H3,(H,22,30)(H,24,29)/t9-,10+,11+,12-,13?,14?,15?,16+,17?,19?/m0/s1 |
| InChIKey | ABNIVIRDLADASI-GSYRMBPTSA-N |
| XLogP | -1.71 |
| TPSA | 152.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.04 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|