C24H32ClFN2O6S — CID 137487081
N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(2-fluorophenyl)-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 137487081) has the molecular formula C24H32ClFN2O6S and a molecular weight of 531.05 g/mol. Its IUPAC name is N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(2-fluorophenyl)-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(2-fluorophenyl)-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 137487081 |
| Molecular Formula | C24H32ClFN2O6S |
| Molecular Weight | 531.05 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(2-fluorophenyl)-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | CSC1OC(C(NC(=O)C2NCC3C=C(c4ccccc4F)CCOC32)C(C)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C24H32ClFN2O6S/c1-11(25)16(22-19(30)18(29)20(31)24(34-22)35-2)28-23(32)17-21-13(10-27-17)9-12(7-8-33-21)14-5-3-4-6-15(14)26/h3-6,9,11,13,16-22,24,27,29-31H,7-8,10H2,1-2H3,(H,28,32) |
| InChIKey | XAMIRPZNNVQIMQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.05 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|