About 6,7-di(propan-2-yl)-1,4-oxazepane
6,7-di(propan-2-yl)-1,4-oxazepane (PubChem CID 137487101) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 6,7-di(propan-2-yl)-1,4-oxazepane.
Molecular Properties
| Compound Name | 6,7-di(propan-2-yl)-1,4-oxazepane |
| PubChem CID | 137487101 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 6,7-di(propan-2-yl)-1,4-oxazepane |
| SMILES | CC(C)C1CNCCOC1C(C)C |
| InChI | InChI=1S/C11H23NO/c1-8(2)10-7-12-5-6-13-11(10)9(3)4/h8-12H,5-7H2,1-4H3 |
| InChIKey | VLMXZHUHEZGOJR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-di(propan-2-yl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-di(propan-2-yl)-1,4-oxazepane?
The IUPAC name of 6,7-di(propan-2-yl)-1,4-oxazepane (CID 137487101) is 6,7-di(propan-2-yl)-1,4-oxazepane.
What is the SMILES notation for 6,7-di(propan-2-yl)-1,4-oxazepane?
The canonical SMILES for 6,7-di(propan-2-yl)-1,4-oxazepane is CC(C)C1CNCCOC1C(C)C.
What is the InChIKey of 6,7-di(propan-2-yl)-1,4-oxazepane?
The InChIKey is VLMXZHUHEZGOJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-8(2)10-7-12-5-6-13-11(10)9(3)4/h8-12H,5-7H2,1-4H3.
What are the key properties of 6,7-di(propan-2-yl)-1,4-oxazepane?
6,7-di(propan-2-yl)-1,4-oxazepane has a molecular weight of 185.31 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-di(propan-2-yl)-1,4-oxazepane is sourced from PubChem (CID 137487101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).