C15H20O4S — CID 137487121
[(2S)-2-formylpent-4-enyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 137487121) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is [(2S)-2-formylpent-4-enyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [(2S)-2-formylpent-4-enyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 137487121 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | [(2S)-2-formylpent-4-enyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | C=CC[C@H](C=O)COS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H20O4S/c1-5-6-14(9-16)10-19-20(17,18)15-12(3)7-11(2)8-13(15)4/h5,7-9,14H,1,6,10H2,2-4H3/t14-/m1/s1 |
| InChIKey | QCGOJYOAOKNDOV-CQSZACIVSA-N |
| XLogP | 2.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|