C24H31ClF2N2O6S — CID 137487145
(5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(3,5-difluorophenyl)-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 137487145) has the molecular formula C24H31ClF2N2O6S and a molecular weight of 549.04 g/mol. Its IUPAC name is (5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(3,5-difluorophenyl)-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | (5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(3,5-difluorophenyl)-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 137487145 |
| Molecular Formula | C24H31ClF2N2O6S |
| Molecular Weight | 549.04 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | (5aS,8S,8aR)-N-[(1S,2S)-2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-(3,5-difluorophenyl)-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | CSC1OC([C@H](NC(=O)[C@H]2NC[C@@H]3C=C(c4cc(F)cc(F)c4)CCO[C@@H]23)[C@H](C)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C24H31ClF2N2O6S/c1-10(25)16(22-19(31)18(30)20(32)24(35-22)36-2)29-23(33)17-21-13(9-28-17)5-11(3-4-34-21)12-6-14(26)8-15(27)7-12/h5-8,10,13,16-22,24,28,30-32H,3-4,9H2,1-2H3,(H,29,33)/t10-,13-,16+,17-,18?,19?,20?,21+,22?,24?/m0/s1 |
| InChIKey | SNBCWQNIIUKFAQ-FMOWSIBESA-N |
| XLogP | 1.01 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.04 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|