C25H34ClF3N2O6S — CID 137487158
N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-[4-(trifluoromethyl)phenyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 137487158) has the molecular formula C25H34ClF3N2O6S and a molecular weight of 583.07 g/mol. Its IUPAC name is N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-[4-(trifluoromethyl)phenyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-[4-(trifluoromethyl)phenyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 137487158 |
| Molecular Formula | C25H34ClF3N2O6S |
| Molecular Weight | 583.07 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-[4-(trifluoromethyl)phenyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | CSC1OC(C(NC(=O)C2NCC3CC(c4ccc(C(F)(F)F)cc4)CCOC32)C(C)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C25H34ClF3N2O6S/c1-11(26)16(22-19(33)18(32)20(34)24(37-22)38-2)31-23(35)17-21-14(10-30-17)9-13(7-8-36-21)12-3-5-15(6-4-12)25(27,28)29/h3-6,11,13-14,16-22,24,30,32-34H,7-10H2,1-2H3,(H,31,35) |
| InChIKey | SLKZZIFHQLNARC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.07 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|