C18H29NO7 — CID 137487160
12-O-tert-butyl 11-O-methyl (1S,3R,7S,10R,11S)-5,5-dimethyl-4,6,9-trioxa-12-azatricyclo[8.3.0.03,7]tridecane-11,12-dicarboxylate (PubChem CID 137487160) has the molecular formula C18H29NO7 and a molecular weight of 371.43 g/mol. Its IUPAC name is 12-O-tert-butyl 11-O-methyl (1S,3R,7S,10R,11S)-5,5-dimethyl-4,6,9-trioxa-12-azatricyclo[8.3.0.03,7]tridecane-11,12-dicarboxylate.
| Compound Name | 12-O-tert-butyl 11-O-methyl (1S,3R,7S,10R,11S)-5,5-dimethyl-4,6,9-trioxa-12-azatricyclo[8.3.0.03,7]tridecane-11,12-dicarboxylate |
|---|---|
| PubChem CID | 137487160 |
| Molecular Formula | C18H29NO7 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 12-O-tert-butyl 11-O-methyl (1S,3R,7S,10R,11S)-5,5-dimethyl-4,6,9-trioxa-12-azatricyclo[8.3.0.03,7]tridecane-11,12-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2OC[C@@H]3OC(C)(C)O[C@@H]3C[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29NO7/c1-17(2,3)26-16(21)19-8-10-7-11-12(25-18(4,5)24-11)9-23-14(10)13(19)15(20)22-6/h10-14H,7-9H2,1-6H3/t10-,11+,12-,13-,14+/m0/s1 |
| InChIKey | DCZBDRBXXSZCBN-ZUWCUPBKSA-N |
| XLogP | 1.70 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |