C15H23NO5 — CID 137487190
7-O-tert-butyl 8-O-methyl (5aS,8S,8aR)-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate (PubChem CID 137487190) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 7-O-tert-butyl 8-O-methyl (5aS,8S,8aR)-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate.
| Compound Name | 7-O-tert-butyl 8-O-methyl (5aS,8S,8aR)-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate |
|---|---|
| PubChem CID | 137487190 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 7-O-tert-butyl 8-O-methyl (5aS,8S,8aR)-2,5,5a,6,8,8a-hexahydrooxepino[2,3-c]pyrrole-7,8-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2OCC=CC[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO5/c1-15(2,3)21-14(18)16-9-10-7-5-6-8-20-12(10)11(16)13(17)19-4/h5-6,10-12H,7-9H2,1-4H3/t10-,11-,12+/m0/s1 |
| InChIKey | XPGUJUDWHCRDLS-SDDRHHMPSA-N |
| XLogP | 1.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|