C26H32ClFN2O6S — CID 137487283
N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-[2-(3-fluorophenyl)ethynyl]-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide (PubChem CID 137487283) has the molecular formula C26H32ClFN2O6S and a molecular weight of 555.07 g/mol. Its IUPAC name is N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-[2-(3-fluorophenyl)ethynyl]-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide.
| Compound Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-[2-(3-fluorophenyl)ethynyl]-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
|---|---|
| PubChem CID | 137487283 |
| Molecular Formula | C26H32ClFN2O6S |
| Molecular Weight | 555.07 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | N-[2-chloro-1-(3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl)propyl]-4-[2-(3-fluorophenyl)ethynyl]-3,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrole-8-carboxamide |
| SMILES | CSC1OC(C(NC(=O)C2NCC3C=C(C#Cc4cccc(F)c4)CCOC32)C(C)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C26H32ClFN2O6S/c1-13(27)18(24-21(32)20(31)22(33)26(36-24)37-2)30-25(34)19-23-16(12-29-19)10-15(8-9-35-23)7-6-14-4-3-5-17(28)11-14/h3-5,10-11,13,16,18-24,26,29,31-33H,8-9,12H2,1-2H3,(H,30,34) |
| InChIKey | YENFYTNPYPIDHA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 120.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.07 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|