C28H42O3 — CID 137487488
(2Z,6E,8Z,12E,14E)-5-methoxy-8,12-dimethyl-16-[5-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]hexadeca-2,6,8,12,14-pentaenal (PubChem CID 137487488) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is (2Z,6E,8Z,12E,14E)-5-methoxy-8,12-dimethyl-16-[5-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]hexadeca-2,6,8,12,14-pentaenal.
| Compound Name | (2Z,6E,8Z,12E,14E)-5-methoxy-8,12-dimethyl-16-[5-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]hexadeca-2,6,8,12,14-pentaenal |
|---|---|
| PubChem CID | 137487488 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | (2Z,6E,8Z,12E,14E)-5-methoxy-8,12-dimethyl-16-[5-methyl-6-[(E)-prop-1-enyl]oxan-2-yl]hexadeca-2,6,8,12,14-pentaenal |
| SMILES | C/C=C/C1OC(C/C=C/C=C(\C)CC/C=C(C)\C=C\C(C/C=C\C=O)OC)CCC1C |
| InChI | InChI=1S/C28H42O3/c1-6-12-28-25(4)19-21-27(31-28)17-8-7-13-23(2)14-11-15-24(3)18-20-26(30-5)16-9-10-22-29/h6-10,12-13,15,18,20,22,25-28H,11,14,16-17,19,21H2,1-5H3/b8-7+,10-9-,12-6+,20-18+,23-13+,24-15- |
| InChIKey | WZFPVYONSUDKRB-FYZZNAOASA-N |
| XLogP | 7.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|