C31H37N5O7 — CID 137487504
[9-[4-[2-[[(Z)-3-amino-4-[amino(propyl)amino]but-3-enoxy]carbonylamino]ethylamino]-2-methylphenyl]-3,6-dihydroxyxanthen-9-yl] formate (PubChem CID 137487504) has the molecular formula C31H37N5O7 and a molecular weight of 591.67 g/mol. Its IUPAC name is [9-[4-[2-[[(Z)-3-amino-4-[amino(propyl)amino]but-3-enoxy]carbonylamino]ethylamino]-2-methylphenyl]-3,6-dihydroxyxanthen-9-yl] formate.
| Compound Name | [9-[4-[2-[[(Z)-3-amino-4-[amino(propyl)amino]but-3-enoxy]carbonylamino]ethylamino]-2-methylphenyl]-3,6-dihydroxyxanthen-9-yl] formate |
|---|---|
| PubChem CID | 137487504 |
| Molecular Formula | C31H37N5O7 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | [9-[4-[2-[[(Z)-3-amino-4-[amino(propyl)amino]but-3-enoxy]carbonylamino]ethylamino]-2-methylphenyl]-3,6-dihydroxyxanthen-9-yl] formate |
| SMILES | CCCN(N)/C=C(\N)CCOC(=O)NCCNc1ccc(C2(OC=O)c3ccc(O)cc3Oc3cc(O)ccc32)c(C)c1 |
| InChI | InChI=1S/C31H37N5O7/c1-3-13-36(33)18-21(32)10-14-41-30(40)35-12-11-34-22-4-7-25(20(2)15-22)31(42-19-37)26-8-5-23(38)16-28(26)43-29-17-24(39)6-9-27(29)31/h4-9,15-19,34,38-39H,3,10-14,32-33H2,1-2H3,(H,35,40)/b21-18- |
| InChIKey | ZBYSXTFSBZSPLC-UZYVYHOESA-N |
| XLogP | 3.89 |
| TPSA | 181.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|