C20H26F2O3 — CID 137487712
(5E,7Z,9E)-7,8-difluoro-9-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methoxy]undeca-5,7,9-trien-1-ol (PubChem CID 137487712) has the molecular formula C20H26F2O3 and a molecular weight of 352.42 g/mol. Its IUPAC name is (5E,7Z,9E)-7,8-difluoro-9-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methoxy]undeca-5,7,9-trien-1-ol.
| Compound Name | (5E,7Z,9E)-7,8-difluoro-9-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methoxy]undeca-5,7,9-trien-1-ol |
|---|---|
| PubChem CID | 137487712 |
| Molecular Formula | C20H26F2O3 |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (5E,7Z,9E)-7,8-difluoro-9-[(5-methoxycyclohepta-1,4,6-trien-1-yl)methoxy]undeca-5,7,9-trien-1-ol |
| SMILES | C/C=C(OCC1=CCC=C(OC)C=C1)\C(F)=C(F)/C=C/CCCCO |
| InChI | InChI=1S/C20H26F2O3/c1-3-19(20(22)18(21)11-6-4-5-7-14-23)25-15-16-9-8-10-17(24-2)13-12-16/h3,6,9-13,23H,4-5,7-8,14-15H2,1-2H3/b11-6+,19-3+,20-18- |
| InChIKey | XNRWAKBZCOKFSJ-FHXCLFLFSA-N |
| XLogP | 5.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|