About N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide
N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide (PubChem CID 137488011) has the molecular formula C4H7N5O2
and a molecular weight of 157.13 g/mol. Its IUPAC name is N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide.
Molecular Properties
| Compound Name | N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide |
| PubChem CID | 137488011 |
| Molecular Formula | C4H7N5O2 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide |
| SMILES | NN(N)C(=O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H7N5O2/c5-9(6)3(10)2-1-7-4(11)8-2/h1H,5-6H2,(H2,7,8,11) |
| InChIKey | HLWBCMIOFNAXHQ-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide?
The IUPAC name of N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide (CID 137488011) is N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide.
What is the SMILES notation for N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide?
The canonical SMILES for N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide is NN(N)C(=O)c1c[nH]c(=O)[nH]1.
What is the InChIKey of N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide?
The InChIKey is HLWBCMIOFNAXHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5O2/c5-9(6)3(10)2-1-7-4(11)8-2/h1H,5-6H2,(H2,7,8,11).
What are the key properties of N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide?
N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide has a molecular weight of 157.13 g/mol, XLogP of -2.11, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diamino-2-oxo-1,3-dihydroimidazole-4-carboxamide is sourced from PubChem (CID 137488011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).