C8H17N3O — CID 137489576
4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine (PubChem CID 137489576) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine.
| Compound Name | 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine |
|---|---|
| PubChem CID | 137489576 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine |
| SMILES | CC1CCOC12CN(N)CC2N |
| InChI | InChI=1S/C8H17N3O/c1-6-2-3-12-8(6)5-11(10)4-7(8)9/h6-7H,2-5,9-10H2,1H3 |
| InChIKey | BBUCPKCJFLPZAR-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|