About 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine
4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine (PubChem CID 137489576) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine.
Molecular Properties
| Compound Name | 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine |
| PubChem CID | 137489576 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine |
| SMILES | CC1CCOC12CN(N)CC2N |
| InChI | InChI=1S/C8H17N3O/c1-6-2-3-12-8(6)5-11(10)4-7(8)9/h6-7H,2-5,9-10H2,1H3 |
| InChIKey | BBUCPKCJFLPZAR-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine?
The IUPAC name of 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine (CID 137489576) is 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine.
What is the SMILES notation for 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine?
The canonical SMILES for 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine is CC1CCOC12CN(N)CC2N.
What is the InChIKey of 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine?
The InChIKey is BBUCPKCJFLPZAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O/c1-6-2-3-12-8(6)5-11(10)4-7(8)9/h6-7H,2-5,9-10H2,1H3.
What are the key properties of 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine?
4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine has a molecular weight of 171.24 g/mol, XLogP of -0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-oxa-7-azaspiro[4.4]nonane-7,9-diamine is sourced from PubChem (CID 137489576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).