About 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine
6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine (PubChem CID 137489578) has the molecular formula C7H15N3O
and a molecular weight of 157.22 g/mol. Its IUPAC name is 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine.
Molecular Properties
| Compound Name | 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine |
| PubChem CID | 137489578 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine |
| SMILES | COC1CN(N)C2(CC2)C1N |
| InChI | InChI=1S/C7H15N3O/c1-11-5-4-10(9)7(2-3-7)6(5)8/h5-6H,2-4,8-9H2,1H3 |
| InChIKey | RYFNJFXWJOQLOK-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine?
The IUPAC name of 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine (CID 137489578) is 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine.
What is the SMILES notation for 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine?
The canonical SMILES for 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine is COC1CN(N)C2(CC2)C1N.
What is the InChIKey of 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine?
The InChIKey is RYFNJFXWJOQLOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O/c1-11-5-4-10(9)7(2-3-7)6(5)8/h5-6H,2-4,8-9H2,1H3.
What are the key properties of 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine?
6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine has a molecular weight of 157.22 g/mol, XLogP of -0.95, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-4-azaspiro[2.4]heptane-4,7-diamine is sourced from PubChem (CID 137489578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).