C14H18N2 — CID 137490010
(2Z,5Z,7E)-N-(2-ethenyliminoethyl)-4-methylidenenona-2,5,7-trien-1-imine (PubChem CID 137490010) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2Z,5Z,7E)-N-(2-ethenyliminoethyl)-4-methylidenenona-2,5,7-trien-1-imine.
| Compound Name | (2Z,5Z,7E)-N-(2-ethenyliminoethyl)-4-methylidenenona-2,5,7-trien-1-imine |
|---|---|
| PubChem CID | 137490010 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (2Z,5Z,7E)-N-(2-ethenyliminoethyl)-4-methylidenenona-2,5,7-trien-1-imine |
| SMILES | C=C/N=C/C/N=C/C=C\C(=C)/C=C\C=C\C |
| InChI | InChI=1S/C14H18N2/c1-4-6-7-9-14(3)10-8-11-16-13-12-15-5-2/h4-12H,2-3,13H2,1H3/b6-4+,9-7-,10-8-,15-12+,16-11+ |
| InChIKey | MAKDWUMMJQTKRT-JOJUHJMUSA-N |
| XLogP | 3.52 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|