C22H22F2N8O2 — CID 137490547
(9S)-5-N-[(1R)-2,2-difluorocyclopropyl]-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 137490547) has the molecular formula C22H22F2N8O2 and a molecular weight of 468.47 g/mol. Its IUPAC name is (9S)-5-N-[(1R)-2,2-difluorocyclopropyl]-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-5-N-[(1R)-2,2-difluorocyclopropyl]-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 137490547 |
| Molecular Formula | C22H22F2N8O2 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (9S)-5-N-[(1R)-2,2-difluorocyclopropyl]-8-N-(6-methyl-1H-pyrazolo[5,4-b]pyridin-3-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | Cc1ccc2c(NC(=O)N3c4nc(C(=O)N[C@@H]5CC5(F)F)ccc4N4CCC[C@H]3C4)n[nH]c2n1 |
| InChI | InChI=1S/C22H22F2N8O2/c1-11-4-5-13-17(25-11)29-30-18(13)28-21(34)32-12-3-2-8-31(10-12)15-7-6-14(26-19(15)32)20(33)27-16-9-22(16,23)24/h4-7,12,16H,2-3,8-10H2,1H3,(H,27,33)(H2,25,28,29,30,34)/t12-,16+/m0/s1 |
| InChIKey | WBGVLYUDJZRPAP-BLLLJJGKSA-N |
| XLogP | 2.82 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |