C21H26O2S — CID 137490755
1,11-dimethyl-13-thiahexacyclo[9.6.1.13,7.15,9.02,10.012,17]icos-2(10)-ene-16,18-dione (PubChem CID 137490755) has the molecular formula C21H26O2S and a molecular weight of 342.50 g/mol. Its IUPAC name is 1,11-dimethyl-13-thiahexacyclo[9.6.1.13,7.15,9.02,10.012,17]icos-2(10)-ene-16,18-dione.
| Compound Name | 1,11-dimethyl-13-thiahexacyclo[9.6.1.13,7.15,9.02,10.012,17]icos-2(10)-ene-16,18-dione |
|---|---|
| PubChem CID | 137490755 |
| Molecular Formula | C21H26O2S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1,11-dimethyl-13-thiahexacyclo[9.6.1.13,7.15,9.02,10.012,17]icos-2(10)-ene-16,18-dione |
| SMILES | CC12C(=O)C(C)(C3=C1C1CC4CC(C1)CC3C4)C1C(=O)CCSC12 |
| InChI | InChI=1S/C21H26O2S/c1-20-15-12-6-10-5-11(7-12)9-13(8-10)16(15)21(2,19(20)23)18-17(20)14(22)3-4-24-18/h10-13,17-18H,3-9H2,1-2H3 |
| InChIKey | ILJSDMZEZFYVCY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|