C23H21FN2O3S — CID 137490797
(5R)-5-[(2S)-2-[6-(8-fluoronaphthalen-2-yl)-2-oxo-1H-pyridin-3-yl]-3-methylbutyl]-1,3-thiazolidine-2,4-dione (PubChem CID 137490797) has the molecular formula C23H21FN2O3S and a molecular weight of 424.50 g/mol. Its IUPAC name is (5R)-5-[(2S)-2-[6-(8-fluoronaphthalen-2-yl)-2-oxo-1H-pyridin-3-yl]-3-methylbutyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-5-[(2S)-2-[6-(8-fluoronaphthalen-2-yl)-2-oxo-1H-pyridin-3-yl]-3-methylbutyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 137490797 |
| Molecular Formula | C23H21FN2O3S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (5R)-5-[(2S)-2-[6-(8-fluoronaphthalen-2-yl)-2-oxo-1H-pyridin-3-yl]-3-methylbutyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)[C@H](C[C@H]1SC(=O)NC1=O)c1ccc(-c2ccc3cccc(F)c3c2)[nH]c1=O |
| InChI | InChI=1S/C23H21FN2O3S/c1-12(2)16(11-20-22(28)26-23(29)30-20)15-8-9-19(25-21(15)27)14-7-6-13-4-3-5-18(24)17(13)10-14/h3-10,12,16,20H,11H2,1-2H3,(H,25,27)(H,26,28,29)/t16-,20+/m0/s1 |
| InChIKey | JIWDAZJAHHBDEK-OXJNMPFZSA-N |
| XLogP | 4.82 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|