C47H33N — CID 137494447
N-(2,4-dimethylphenyl)-N-phenylspiro[fluorene-9,12'-pentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14(19),15,17,20-decaene]-17'-amine (PubChem CID 137494447) has the molecular formula C47H33N and a molecular weight of 611.80 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N-phenylspiro[fluorene-9,12'-pentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14(19),15,17,20-decaene]-17'-amine.
| Compound Name | N-(2,4-dimethylphenyl)-N-phenylspiro[fluorene-9,12'-pentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14(19),15,17,20-decaene]-17'-amine |
|---|---|
| PubChem CID | 137494447 |
| Molecular Formula | C47H33N |
| Molecular Weight | 611.80 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N-phenylspiro[fluorene-9,12'-pentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1(13),2,4,6,8,10,14(19),15,17,20-decaene]-17'-amine |
| SMILES | CC1=CC(=C(C=C1)N(C2=CC=CC=C2)C3=CC4=C(C=C3)C5=C(C=C4)C6=CC7=CC=CC=C7C=C6C58C9=CC=CC=C9C1=CC=CC=C81)C |
| InChI | InChI=1S/C47H33N/c1-30-20-25-45(31(2)26-30)48(35-14-4-3-5-15-35)36-22-24-37-34(27-36)21-23-40-41-28-32-12-6-7-13-33(32)29-44(41)47(46(37)40)42-18-10-8-16-38(42)39-17-9-11-19-43(39)47/h3-29H,1-2H3 |
| InChIKey | UABGBQDGESVVIT-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 3.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | 1100 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.80 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |