About (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine
(4Z)-4-ethylidene-9-methylidene-1,5-thiazonine (PubChem CID 137495089) has the molecular formula C10H11NS
and a molecular weight of 177.27 g/mol. Its IUPAC name is (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine.
Molecular Properties
| Compound Name | (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine |
| PubChem CID | 137495089 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine |
| SMILES | C=c1cccn/c(=C\C)ccs1 |
| InChI | InChI=1S/C10H11NS/c1-3-10-6-8-12-9(2)5-4-7-11-10/h3-8H,2H2,1H3/b5-4-,8-6-,10-3-,11-7- |
| InChIKey | YUASMOMEPVYYIP-ROMWKIMTSA-N |
| XLogP | 1.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine?
The IUPAC name of (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine (CID 137495089) is (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine.
What is the SMILES notation for (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine?
The canonical SMILES for (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine is C=c1cccn/c(=C\C)ccs1.
What is the InChIKey of (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine?
The InChIKey is YUASMOMEPVYYIP-ROMWKIMTSA-N. The full InChI is InChI=1S/C10H11NS/c1-3-10-6-8-12-9(2)5-4-7-11-10/h3-8H,2H2,1H3/b5-4-,8-6-,10-3-,11-7-.
What are the key properties of (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine?
(4Z)-4-ethylidene-9-methylidene-1,5-thiazonine has a molecular weight of 177.27 g/mol, XLogP of 1.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-ethylidene-9-methylidene-1,5-thiazonine is sourced from PubChem (CID 137495089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).