C32H34N8O4 — CID 137495291
N-cyano-2-methoxy-5-[5-[[(3S,4R)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]pyridine-3-carboxamide (PubChem CID 137495291) has the molecular formula C32H34N8O4 and a molecular weight of 594.68 g/mol. Its IUPAC name is N-cyano-2-methoxy-5-[5-[[(3S,4R)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]pyridine-3-carboxamide.
| Compound Name | N-cyano-2-methoxy-5-[5-[[(3S,4R)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 137495291 |
| Molecular Formula | C32H34N8O4 |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | N-cyano-2-methoxy-5-[5-[[(3S,4R)-1-(2-methoxyethyl)-4-phenylpyrrolidin-3-yl]carbamoylamino]-4-methyl-1-phenylpyrazol-3-yl]pyridine-3-carboxamide |
| SMILES | COCCN1C[C@@H](NC(=O)Nc2c(C)c(-c3cnc(OC)c(C(=O)NC#N)c3)nn2-c2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C32H34N8O4/c1-21-28(23-16-25(30(41)35-20-33)31(44-3)34-17-23)38-40(24-12-8-5-9-13-24)29(21)37-32(42)36-27-19-39(14-15-43-2)18-26(27)22-10-6-4-7-11-22/h4-13,16-17,26-27H,14-15,18-19H2,1-3H3,(H,35,41)(H2,36,37,42)/t26-,27+/m0/s1 |
| InChIKey | ZILPRAIKLHEJSS-RRPNLBNLSA-N |
| XLogP | 3.70 |
| TPSA | 146.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|