About (3-ethylphenyl)methyl cyclopropanecarboxylate
(3-ethylphenyl)methyl cyclopropanecarboxylate (PubChem CID 137495375) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is (3-ethylphenyl)methyl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | (3-ethylphenyl)methyl cyclopropanecarboxylate |
| PubChem CID | 137495375 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (3-ethylphenyl)methyl cyclopropanecarboxylate |
| SMILES | CCc1cccc(COC(=O)C2CC2)c1 |
| InChI | InChI=1S/C13H16O2/c1-2-10-4-3-5-11(8-10)9-15-13(14)12-6-7-12/h3-5,8,12H,2,6-7,9H2,1H3 |
| InChIKey | KUQJEFJHUFWCSD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-ethylphenyl)methyl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethylphenyl)methyl cyclopropanecarboxylate?
The IUPAC name of (3-ethylphenyl)methyl cyclopropanecarboxylate (CID 137495375) is (3-ethylphenyl)methyl cyclopropanecarboxylate.
What is the SMILES notation for (3-ethylphenyl)methyl cyclopropanecarboxylate?
The canonical SMILES for (3-ethylphenyl)methyl cyclopropanecarboxylate is CCc1cccc(COC(=O)C2CC2)c1.
What is the InChIKey of (3-ethylphenyl)methyl cyclopropanecarboxylate?
The InChIKey is KUQJEFJHUFWCSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-10-4-3-5-11(8-10)9-15-13(14)12-6-7-12/h3-5,8,12H,2,6-7,9H2,1H3.
What are the key properties of (3-ethylphenyl)methyl cyclopropanecarboxylate?
(3-ethylphenyl)methyl cyclopropanecarboxylate has a molecular weight of 204.27 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethylphenyl)methyl cyclopropanecarboxylate is sourced from PubChem (CID 137495375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).