C9H16N6O2 — CID 137495444
[(3aS)-2-amino-5-hydroxy-6-imino-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-4-yl]methanol (PubChem CID 137495444) has the molecular formula C9H16N6O2 and a molecular weight of 240.27 g/mol. Its IUPAC name is [(3aS)-2-amino-5-hydroxy-6-imino-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-4-yl]methanol.
| Compound Name | [(3aS)-2-amino-5-hydroxy-6-imino-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-4-yl]methanol |
|---|---|
| PubChem CID | 137495444 |
| Molecular Formula | C9H16N6O2 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | [(3aS)-2-amino-5-hydroxy-6-imino-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-4-yl]methanol |
| SMILES | [H]/N=C1\N(O)C(CO)[C@@H]2N=C(N)NC23CCCN13 |
| InChI | InChI=1S/C9H16N6O2/c10-7-12-6-5(4-16)15(17)8(11)14-3-1-2-9(6,14)13-7/h5-6,11,16-17H,1-4H2,(H3,10,12,13)/b11-8-/t5?,6-,9?/m0/s1 |
| InChIKey | AJUQOHHVKRGJCI-DZHPQDEGSA-N |
| XLogP | -1.93 |
| TPSA | 121.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|