C23H28ClN5O3S — CID 137495781
S-[[5-[5-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]-3-oxo-1H-isoindol-2-yl]] N-tert-butyl-N-methylcarbamothioate (PubChem CID 137495781) has the molecular formula C23H28ClN5O3S and a molecular weight of 490.03 g/mol. Its IUPAC name is S-[[5-[5-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]-3-oxo-1H-isoindol-2-yl]] N-tert-butyl-N-methylcarbamothioate.
| Compound Name | S-[[5-[5-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]-3-oxo-1H-isoindol-2-yl]] N-tert-butyl-N-methylcarbamothioate |
|---|---|
| PubChem CID | 137495781 |
| Molecular Formula | C23H28ClN5O3S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | S-[[5-[5-chloro-2-(oxan-4-ylamino)pyrimidin-4-yl]-3-oxo-1H-isoindol-2-yl]] N-tert-butyl-N-methylcarbamothioate |
| SMILES | CN(C(=O)SN1Cc2ccc(-c3nc(NC4CCOCC4)ncc3Cl)cc2C1=O)C(C)(C)C |
| InChI | InChI=1S/C23H28ClN5O3S/c1-23(2,3)28(4)22(31)33-29-13-15-6-5-14(11-17(15)20(29)30)19-18(24)12-25-21(27-19)26-16-7-9-32-10-8-16/h5-6,11-12,16H,7-10,13H2,1-4H3,(H,25,26,27) |
| InChIKey | KIYPPJFTJVRCFA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|