C31H39ClN6O4 — CID 137496103
[5-[2-[4-[2-amino-8-[(4-chlorophenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxymethyl]pyrrolidin-2-yl]methanediol (PubChem CID 137496103) has the molecular formula C31H39ClN6O4 and a molecular weight of 595.14 g/mol. Its IUPAC name is [5-[2-[4-[2-amino-8-[(4-chlorophenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxymethyl]pyrrolidin-2-yl]methanediol.
| Compound Name | [5-[2-[4-[2-amino-8-[(4-chlorophenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxymethyl]pyrrolidin-2-yl]methanediol |
|---|---|
| PubChem CID | 137496103 |
| Molecular Formula | C31H39ClN6O4 |
| Molecular Weight | 595.14 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | [5-[2-[4-[2-amino-8-[(4-chlorophenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxymethyl]pyrrolidin-2-yl]methanediol |
| SMILES | Nc1nc2c(c(N3CCN(CCOCC4CCC(C(O)O)N4)CC3)n1)CCc1cc(OCc3ccc(Cl)cc3)ccc1-2 |
| InChI | InChI=1S/C31H39ClN6O4/c32-22-4-1-20(2-5-22)18-42-24-7-9-25-21(17-24)3-8-26-28(25)35-31(33)36-29(26)38-13-11-37(12-14-38)15-16-41-19-23-6-10-27(34-23)30(39)40/h1-2,4-5,7,9,17,23,27,30,34,39-40H,3,6,8,10-16,18-19H2,(H2,33,35,36) |
| InChIKey | YEBUZUCVHMXSDA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.14 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|