C30H39N7O5 — CID 137496105
[2-[2-[4-[2-amino-8-[(4-hydroxyphenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxymethyl]imidazolidin-4-yl]methanediol (PubChem CID 137496105) has the molecular formula C30H39N7O5 and a molecular weight of 577.69 g/mol. Its IUPAC name is [2-[2-[4-[2-amino-8-[(4-hydroxyphenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxymethyl]imidazolidin-4-yl]methanediol.
| Compound Name | [2-[2-[4-[2-amino-8-[(4-hydroxyphenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxymethyl]imidazolidin-4-yl]methanediol |
|---|---|
| PubChem CID | 137496105 |
| Molecular Formula | C30H39N7O5 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | [2-[2-[4-[2-amino-8-[(4-hydroxyphenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]ethoxymethyl]imidazolidin-4-yl]methanediol |
| SMILES | Nc1nc2c(c(N3CCN(CCOCC4NCC(C(O)O)N4)CC3)n1)CCc1cc(OCc3ccc(O)cc3)ccc1-2 |
| InChI | InChI=1S/C30H39N7O5/c31-30-34-27-23-8-6-22(42-17-19-1-4-21(38)5-2-19)15-20(23)3-7-24(27)28(35-30)37-11-9-36(10-12-37)13-14-41-18-26-32-16-25(33-26)29(39)40/h1-2,4-6,8,15,25-26,29,32-33,38-40H,3,7,9-14,16-18H2,(H2,31,34,35) |
| InChIKey | OHIOXNHBYDPBFU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 161.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|