C51H29N3OS2 — CID 137496709
2-[6,8-di(dibenzothiophen-3-yl)dibenzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 137496709) has the molecular formula C51H29N3OS2 and a molecular weight of 763.95 g/mol. Its IUPAC name is 2-[6,8-di(dibenzothiophen-3-yl)dibenzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[6,8-di(dibenzothiophen-3-yl)dibenzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 137496709 |
| Molecular Formula | C51H29N3OS2 |
| Molecular Weight | 763.95 g/mol |
| Exact Mass | 763.18 |
| IUPAC Name | 2-[6,8-di(dibenzothiophen-3-yl)dibenzofuran-4-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4c3oc3c(-c5ccc6c(c5)sc5ccccc56)cc(-c5ccc6c(c5)sc5ccccc56)cc34)n2)cc1 |
| InChI | InChI=1S/C51H29N3OS2/c1-3-12-30(13-4-1)49-52-50(31-14-5-2-6-15-31)54-51(53-49)40-19-11-18-39-42-27-34(32-22-24-37-35-16-7-9-20-43(35)56-45(37)28-32)26-41(48(42)55-47(39)40)33-23-25-38-36-17-8-10-21-44(36)57-46(38)29-33/h1-29H |
| InChIKey | IOJUFBANYRFRNG-UHFFFAOYSA-N |
| XLogP | 14.84 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.95 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |