About methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol
methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol (PubChem CID 137497560) has the molecular formula C14H34O3
and a molecular weight of 250.42 g/mol. Its IUPAC name is methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol.
Molecular Properties
| Compound Name | methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol |
| PubChem CID | 137497560 |
| Molecular Formula | C14H34O3 |
| Molecular Weight | 250.42 g/mol |
| Exact Mass | 250.25 |
| IUPAC Name | methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol |
| SMILES | CC(C)O.CCC(C)(C)OC(C)(C)CC.CO |
| InChI | InChI=1S/C10H22O.C3H8O.CH4O/c1-7-9(3,4)11-10(5,6)8-2;1-3(2)4;1-2/h7-8H2,1-6H3;3-4H,1-2H3;2H,1H3 |
| InChIKey | LDVCVBAYMSXCNA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol?
The IUPAC name of methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol (CID 137497560) is methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol.
What is the SMILES notation for methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol?
The canonical SMILES for methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol is CC(C)O.CCC(C)(C)OC(C)(C)CC.CO.
What is the InChIKey of methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol?
The InChIKey is LDVCVBAYMSXCNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O.C3H8O.CH4O/c1-7-9(3,4)11-10(5,6)8-2;1-3(2)4;1-2/h7-8H2,1-6H3;3-4H,1-2H3;2H,1H3.
What are the key properties of methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol?
methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol has a molecular weight of 250.42 g/mol, XLogP of 3.38, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methyl-2-(2-methylbutan-2-yloxy)butane;propan-2-ol is sourced from PubChem (CID 137497560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).