About 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile
4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile (PubChem CID 137497635) has the molecular formula C27H16BrN5
and a molecular weight of 490.36 g/mol. Its IUPAC name is 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile.
Molecular Properties
| Compound Name | 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile |
| PubChem CID | 137497635 |
| Molecular Formula | C27H16BrN5 |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile |
| SMILES | N#Cc1c(-c2cccnc2)c(-c2cccnc2)c(Br)c(-c2cccnc2)c1-c1cccnc1 |
| InChI | InChI=1S/C27H16BrN5/c28-27-25(20-7-3-11-32-16-20)23(18-5-1-9-30-14-18)22(13-29)24(19-6-2-10-31-15-19)26(27)21-8-4-12-33-17-21/h1-12,14-17H |
| InChIKey | HEMCLBKOJTWPCJ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile?
The IUPAC name of 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile (CID 137497635) is 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile.
What is the SMILES notation for 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile?
The canonical SMILES for 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile is N#Cc1c(-c2cccnc2)c(-c2cccnc2)c(Br)c(-c2cccnc2)c1-c1cccnc1.
What is the InChIKey of 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile?
The InChIKey is HEMCLBKOJTWPCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H16BrN5/c28-27-25(20-7-3-11-32-16-20)23(18-5-1-9-30-14-18)22(13-29)24(19-6-2-10-31-15-19)26(27)21-8-4-12-33-17-21/h1-12,14-17H.
What are the key properties of 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile?
4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile has a molecular weight of 490.36 g/mol, XLogP of 6.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,3,5,6-tetrapyridin-3-ylbenzonitrile is sourced from PubChem (CID 137497635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).