C30H32N5O7P — CID 137497929
phosphono 2-hydroxy-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate (PubChem CID 137497929) has the molecular formula C30H32N5O7P and a molecular weight of 605.59 g/mol. Its IUPAC name is phosphono 2-hydroxy-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate.
| Compound Name | phosphono 2-hydroxy-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 137497929 |
| Molecular Formula | C30H32N5O7P |
| Molecular Weight | 605.59 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | phosphono 2-hydroxy-3-[N-[4-[methyl-[2-(4-methylpiperazin-1-yl)acetyl]amino]phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate |
| SMILES | CN1CCN(CC(=O)N(C)c2ccc(/N=C(\c3ccccc3)c3c(O)[nH]c4cc(C(=O)OP(=O)(O)O)ccc34)cc2)CC1 |
| InChI | InChI=1S/C30H32N5O7P/c1-33-14-16-35(17-15-33)19-26(36)34(2)23-11-9-22(10-12-23)31-28(20-6-4-3-5-7-20)27-24-13-8-21(18-25(24)32-29(27)37)30(38)42-43(39,40)41/h3-13,18,32,37H,14-17,19H2,1-2H3,(H2,39,40,41)/b31-28+ |
| InChIKey | VPPODLSOINMSCA-CCFHIKDMSA-N |
| XLogP | 3.50 |
| TPSA | 159.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|